jazzlashayy2393 jazzlashayy2393
  • 02-10-2017
  • History
contestada

Which group of invaders were descendants of the huns, fought on horseback, and invaded europe from the east?

Respuesta :

ztoole55 ztoole55
  • 03-10-2017
The Magyars

"Hungarians (= the Magyars) are the descendants of Magor, and the Huns are the descendants of his brother, Hunor. So these are two different nations. The Huns are already extinct / melted to other nations"

technically they're not the descendants of the Huns but they were the only ones I could find. I hope this helps you!!
Answer Link

Otras preguntas

A wire is carrying current vertically downward. What is the direction of the force due to Earth's magnetic field on the wire?
The requirement to earn all the necessary degree in Law​
explain any four basic values of Indian constitution as mentioned in the Preamble to Indian constitution.
Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl
Describe the various ethical principles reviewed and how they might be helpful in resolving health care ethical dilemmas.
solve 2<2x+4<10 for x
identify(describe) each part of the ellipse as labeled by a letter​
What is the angle taken in anticlockwise direction from north to: (1) south-west. (2) south. ​
Take an electric field sensor and move it in a straight line, crossing the equipotential lines. Describe the relationship between the distance between the equip
What’s the function of the Unit Circle and why is it called the unit Circle?