jtkgotosleep123 jtkgotosleep123

01-12-2020
Mathematics

contestada

what is the exact value of cos(11pi/21)cos(pi/7)-sin(11pi/21)sin(pi/7)?

a. -squr3/2
b. -1/2
c. 1/2
d. squr3/2

Respuesta :

funnymunchies2004 funnymunchies2004

07-12-2020

Answer:

B

Step-by-step explanation:

-1/2

Answer Link

camjjwo camjjwo

12-06-2021

Answer:

B -1/2

Step-by-step explanation:

Answer Link

Otras preguntas

When atoms of different elements combine, the new molecules are called:

Ashley's penny bank is 1/4 full. After she adds 400 pennies, it is 2/3 full. How many pennies can Ashley's bank hold?

Does anyone get these questions?

David has $65 dollars to spend on a ticket to a concert and a shirt. He already spent $32.25 on his ticket and fee. Find an equality that could be used to find

How to do #9 because I do not get it at all

There are 785 students in the senior class. If there are 77 more females in the class than males, how many male and female seniors are there in class?

What is the 8th term in the sequence? Note: Use the explicit rule. [tex]a_n=25-3n[/tex]

Compare the views of ancient Sparta and ancient Athens on the subject of education. A. Athens valued education and family, while Sparta valued only education. B

Which two chemical substances are needed to begin the photosynthesis factory process ____

how do I know if it's undefined or 0 ????