justtryingtopass28 justtryingtopass28

04-04-2019
Mathematics

contestada

If 6a+4b+c=-7, what is -2c-12a-8b

Respuesta :

minecraftdude21Rand minecraftdude21Rand

04-04-2019

Answer:

solve for each variable then plug them in

Step-by-step explanation:

Answer Link

Otras preguntas

Cities in the Middle East are located near what natural resource ?

Find height of triangle in a 45-45-90 triangle knowing one side

14. In an oblique triangle, find the side b if c = 12, A = 50º12', and B = 72º58'. A. 11 B. 1 C. 15 D. 14

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

a historian wants to compare the causes of death in the people of a particular civilzation. she wants to show each cause of death. which form of visual represen

Myco- and tinea (myco/statin; tinea corporis) mean:

In a survey of high school students, nearly half of the students surveyed believed that when a woman says "no" to a sexual advance, she doesn't really mean it.

At jim's juice factory, his machine can fill 300 juice boxes an hour. Each box holds 0.8 cups How many gallons of juice does jim's factory need per hour?

The body's backup system of respiratory control, which is based on low concentrations of oxygen in the blood, is called the

Which type of chemical messenger do the male gonads secrete?